C17H23ClN4O2 — CID 119537008
1-(4-methoxyphenyl)-N-(2-pyrrolidin-3-ylethyl)pyrazole-3-carboxamide;hydrochloride (PubChem CID 119537008) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(2-pyrrolidin-3-ylethyl)pyrazole-3-carboxamide;hydrochloride.
| Compound Name | 1-(4-methoxyphenyl)-N-(2-pyrrolidin-3-ylethyl)pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119537008 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(2-pyrrolidin-3-ylethyl)pyrazole-3-carboxamide;hydrochloride |
| SMILES | COc1ccc(-n2ccc(C(=O)NCCC3CCNC3)n2)cc1.Cl |
| InChI | InChI=1S/C17H22N4O2.ClH/c1-23-15-4-2-14(3-5-15)21-11-8-16(20-21)17(22)19-10-7-13-6-9-18-12-13;/h2-5,8,11,13,18H,6-7,9-10,12H2,1H3,(H,19,22);1H |
| InChIKey | RBSMUHBVNQMNSE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |