C29H28ClNO6S — CID 11953768
[(3aR,4S,6R,7S,7aR)-3-benzyl-2-oxo-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] 2-chloroacetate (PubChem CID 11953768) has the molecular formula C29H28ClNO6S and a molecular weight of 554.06 g/mol. Its IUPAC name is [(3aR,4S,6R,7S,7aR)-3-benzyl-2-oxo-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] 2-chloroacetate.
| Compound Name | [(3aR,4S,6R,7S,7aR)-3-benzyl-2-oxo-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 11953768 |
| Molecular Formula | C29H28ClNO6S |
| Molecular Weight | 554.06 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | [(3aR,4S,6R,7S,7aR)-3-benzyl-2-oxo-6-(phenylmethoxymethyl)-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-pyrano[3,4-d][1,3]oxazol-7-yl] 2-chloroacetate |
| SMILES | O=C(CCl)O[C@H]1[C@@H]2OC(=O)N(Cc3ccccc3)[C@H]2[C@H](Sc2ccccc2)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C29H28ClNO6S/c30-16-24(32)36-26-23(19-34-18-21-12-6-2-7-13-21)35-28(38-22-14-8-3-9-15-22)25-27(26)37-29(33)31(25)17-20-10-4-1-5-11-20/h1-15,23,25-28H,16-19H2/t23-,25-,26-,27-,28+/m1/s1 |
| InChIKey | SBQKCOYANQOYLY-LZEBPPIWSA-N |
| XLogP | 5.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|