C7H12O6 — CID 11953802
(2R,3R,4R,5S,6R)-2,3,4,6-tetrahydroxy-5-methoxycyclohexan-1-one (PubChem CID 11953802) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2,3,4,6-tetrahydroxy-5-methoxycyclohexan-1-one.
| Compound Name | (2R,3R,4R,5S,6R)-2,3,4,6-tetrahydroxy-5-methoxycyclohexan-1-one |
|---|---|
| PubChem CID | 11953802 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2,3,4,6-tetrahydroxy-5-methoxycyclohexan-1-one |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O)[C@@H](O)C(=O)[C@@H]1O |
| InChI | InChI=1S/C7H12O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-3,5-9,11-12H,1H3/t2-,3+,5-,6+,7+/m1/s1 |
| InChIKey | VKPFEZAOAAZDPP-QCNSFQOVSA-N |
| XLogP | -2.97 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |