About 2-hydroxyphenolate
2-hydroxyphenolate (PubChem CID 11953850) has the molecular formula C6H5O2-
and a molecular weight of 109.10 g/mol. Its IUPAC name is 2-hydroxyphenolate.
Molecular Properties
| Compound Name | 2-hydroxyphenolate |
| PubChem CID | 11953850 |
| Molecular Formula | C6H5O2- |
| Molecular Weight | 109.10 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | 2-hydroxyphenolate |
| SMILES | [O-]c1ccccc1O |
| InChI | InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H/p-1 |
| InChIKey | YCIMNLLNPGFGHC-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.10 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyphenolate?
The IUPAC name of 2-hydroxyphenolate (CID 11953850) is 2-hydroxyphenolate.
What is the SMILES notation for 2-hydroxyphenolate?
The canonical SMILES for 2-hydroxyphenolate is [O-]c1ccccc1O.
What is the InChIKey of 2-hydroxyphenolate?
The InChIKey is YCIMNLLNPGFGHC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H/p-1.
What are the key properties of 2-hydroxyphenolate?
2-hydroxyphenolate has a molecular weight of 109.10 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyphenolate is sourced from PubChem (CID 11953850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).