C20H26O2 — CID 11954105
(2S,5S,9S,10R)-15-methoxy-5-methyltetracyclo[11.4.1.02,10.05,9]octadeca-1(17),13,15-trien-6-one (PubChem CID 11954105) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (2S,5S,9S,10R)-15-methoxy-5-methyltetracyclo[11.4.1.02,10.05,9]octadeca-1(17),13,15-trien-6-one.
| Compound Name | (2S,5S,9S,10R)-15-methoxy-5-methyltetracyclo[11.4.1.02,10.05,9]octadeca-1(17),13,15-trien-6-one |
|---|---|
| PubChem CID | 11954105 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S,5S,9S,10R)-15-methoxy-5-methyltetracyclo[11.4.1.02,10.05,9]octadeca-1(17),13,15-trien-6-one |
| SMILES | COC1=CC=C2CC(=C1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H26O2/c1-20-10-9-16-14-4-5-15(22-2)12-13(11-14)3-6-17(16)18(20)7-8-19(20)21/h4-5,12,16-18H,3,6-11H2,1-2H3/t16-,17-,18+,20+/m1/s1 |
| InChIKey | FBRCEPPRCFBOKU-XSYGEPLQSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |