C20H24N2OS — CID 119541802
(4-benzylsulfanylphenyl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone (PubChem CID 119541802) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is (4-benzylsulfanylphenyl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-benzylsulfanylphenyl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119541802 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (4-benzylsulfanylphenyl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone |
| SMILES | CNCC1CCN(C(=O)c2ccc(SCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C20H24N2OS/c1-21-13-17-11-12-22(14-17)20(23)18-7-9-19(10-8-18)24-15-16-5-3-2-4-6-16/h2-10,17,21H,11-15H2,1H3 |
| InChIKey | CQHDLWKHAIBAFD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |