C19H25ClN2O — CID 119542656
1-[4-(methylaminomethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone;hydrochloride (PubChem CID 119542656) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is 1-[4-(methylaminomethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone;hydrochloride.
| Compound Name | 1-[4-(methylaminomethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119542656 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[4-(methylaminomethyl)piperidin-1-yl]-2-naphthalen-2-ylethanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)Cc2ccc3ccccc3c2)CC1.Cl |
| InChI | InChI=1S/C19H24N2O.ClH/c1-20-14-15-8-10-21(11-9-15)19(22)13-16-6-7-17-4-2-3-5-18(17)12-16;/h2-7,12,15,20H,8-11,13-14H2,1H3;1H |
| InChIKey | ODYFTLZCOJCEJU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |