C14H18ClF2IN2O — CID 119543684
(4,5-difluoro-2-iodophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119543684) has the molecular formula C14H18ClF2IN2O and a molecular weight of 430.66 g/mol. Its IUPAC name is (4,5-difluoro-2-iodophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (4,5-difluoro-2-iodophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119543684 |
| Molecular Formula | C14H18ClF2IN2O |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | (4,5-difluoro-2-iodophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2cc(F)c(F)cc2I)CC1.Cl |
| InChI | InChI=1S/C14H17F2IN2O.ClH/c1-18-8-9-2-4-19(5-3-9)14(20)10-6-11(15)12(16)7-13(10)17;/h6-7,9,18H,2-5,8H2,1H3;1H |
| InChIKey | HDMWBMKUQLNYDW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|