C12H19ClN4O3 — CID 119544028
[4-(methylaminomethyl)piperidin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride (PubChem CID 119544028) has the molecular formula C12H19ClN4O3 and a molecular weight of 302.76 g/mol. Its IUPAC name is [4-(methylaminomethyl)piperidin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [4-(methylaminomethyl)piperidin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119544028 |
| Molecular Formula | C12H19ClN4O3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [4-(methylaminomethyl)piperidin-1-yl]-(5-nitro-1H-pyrrol-2-yl)methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2ccc([N+](=O)[O-])[nH]2)CC1.Cl |
| InChI | InChI=1S/C12H18N4O3.ClH/c1-13-8-9-4-6-15(7-5-9)12(17)10-2-3-11(14-10)16(18)19;/h2-3,9,13-14H,4-8H2,1H3;1H |
| InChIKey | BNMZRRPCWAFZBA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|