C23H24N2O3 — CID 11954449
methyl (3aS,4S,9bS)-1-benzyl-2-oxo-4-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-pyrrolo[3,2-c]quinoline-8-carboxylate (PubChem CID 11954449) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is methyl (3aS,4S,9bS)-1-benzyl-2-oxo-4-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-pyrrolo[3,2-c]quinoline-8-carboxylate.
| Compound Name | methyl (3aS,4S,9bS)-1-benzyl-2-oxo-4-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-pyrrolo[3,2-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 11954449 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | methyl (3aS,4S,9bS)-1-benzyl-2-oxo-4-prop-2-enyl-3a,4,5,9b-tetrahydro-3H-pyrrolo[3,2-c]quinoline-8-carboxylate |
| SMILES | C=CC[C@@H]1Nc2ccc(C(=O)OC)cc2[C@@H]2[C@H]1CC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O3/c1-3-7-19-18-13-21(26)25(14-15-8-5-4-6-9-15)22(18)17-12-16(23(27)28-2)10-11-20(17)24-19/h3-6,8-12,18-19,22,24H,1,7,13-14H2,2H3/t18-,19-,22+/m0/s1 |
| InChIKey | GTCJKIHSSMYTNU-CNNODRBYSA-N |
| XLogP | 3.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|