C21H27ClN2O2 — CID 119544892
[4-(methylaminomethyl)piperidin-1-yl]-[2-(phenoxymethyl)phenyl]methanone;hydrochloride (PubChem CID 119544892) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is [4-(methylaminomethyl)piperidin-1-yl]-[2-(phenoxymethyl)phenyl]methanone;hydrochloride.
| Compound Name | [4-(methylaminomethyl)piperidin-1-yl]-[2-(phenoxymethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119544892 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [4-(methylaminomethyl)piperidin-1-yl]-[2-(phenoxymethyl)phenyl]methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2ccccc2COc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C21H26N2O2.ClH/c1-22-15-17-11-13-23(14-12-17)21(24)20-10-6-5-7-18(20)16-25-19-8-3-2-4-9-19;/h2-10,17,22H,11-16H2,1H3;1H |
| InChIKey | ABQXZNSOACDTLL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |