C14H20ClFN4O3 — CID 119544910
(2-amino-5-fluoro-3-nitrophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119544910) has the molecular formula C14H20ClFN4O3 and a molecular weight of 346.79 g/mol. Its IUPAC name is (2-amino-5-fluoro-3-nitrophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (2-amino-5-fluoro-3-nitrophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119544910 |
| Molecular Formula | C14H20ClFN4O3 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2-amino-5-fluoro-3-nitrophenyl)-[4-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2cc(F)cc([N+](=O)[O-])c2N)CC1.Cl |
| InChI | InChI=1S/C14H19FN4O3.ClH/c1-17-8-9-2-4-18(5-3-9)14(20)11-6-10(15)7-12(13(11)16)19(21)22;/h6-7,9,17H,2-5,8,16H2,1H3;1H |
| InChIKey | XDFJEQMXBLWJAO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|