About N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide
N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide (PubChem CID 11954518) has the molecular formula C23H23NO2S
and a molecular weight of 377.51 g/mol. Its IUPAC name is N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide |
| PubChem CID | 11954518 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO2S/c1-19-14-16-22(17-15-19)27(25,26)24-18-8-13-23(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-17,24H,8,18H2,1H3 |
| InChIKey | BEJIAXGPIJIYOQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide?
The IUPAC name of N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide (CID 11954518) is N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide.
What is the SMILES notation for N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide?
The canonical SMILES for N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)NCCC=C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide?
The InChIKey is BEJIAXGPIJIYOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO2S/c1-19-14-16-22(17-15-19)27(25,26)24-18-8-13-23(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-17,24H,8,18H2,1H3.
What are the key properties of N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide?
N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide has a molecular weight of 377.51 g/mol, XLogP of 4.80, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-diphenylbut-3-enyl)-4-methylbenzenesulfonamide is sourced from PubChem (CID 11954518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).