C14H34O3Si2 — CID 11954591
(2S,3R,4S)-5,5-dimethyl-2,4-bis(trimethylsilyloxy)hexan-3-ol (PubChem CID 11954591) has the molecular formula C14H34O3Si2 and a molecular weight of 306.60 g/mol. Its IUPAC name is (2S,3R,4S)-5,5-dimethyl-2,4-bis(trimethylsilyloxy)hexan-3-ol.
| Compound Name | (2S,3R,4S)-5,5-dimethyl-2,4-bis(trimethylsilyloxy)hexan-3-ol |
|---|---|
| PubChem CID | 11954591 |
| Molecular Formula | C14H34O3Si2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (2S,3R,4S)-5,5-dimethyl-2,4-bis(trimethylsilyloxy)hexan-3-ol |
| SMILES | C[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H34O3Si2/c1-11(16-18(5,6)7)12(15)13(14(2,3)4)17-19(8,9)10/h11-13,15H,1-10H3/t11-,12+,13+/m0/s1 |
| InChIKey | RSGOWXLJJIBOSY-YNEHKIRRSA-N |
| XLogP | 3.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|