C23H54O3Si3 — CID 11954592
[(1S,2R,3S)-1-tert-butyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybutoxy]-trimethylsilane (PubChem CID 11954592) has the molecular formula C23H54O3Si3 and a molecular weight of 462.94 g/mol. Its IUPAC name is [(1S,2R,3S)-1-tert-butyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybutoxy]-trimethylsilane.
| Compound Name | [(1S,2R,3S)-1-tert-butyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybutoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11954592 |
| Molecular Formula | C23H54O3Si3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.34 |
| IUPAC Name | [(1S,2R,3S)-1-tert-butyl-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybutoxy]-trimethylsilane |
| SMILES | CC(C)[Si](O[C@H]([C@H](C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H54O3Si3/c1-17(2)29(18(3)4,19(5)6)25-21(20(7)24-27(11,12)13)22(23(8,9)10)26-28(14,15)16/h17-22H,1-16H3/t20-,21+,22+/m0/s1 |
| InChIKey | HIDQIBDSRFGQCN-BHDDXSALSA-N |
| XLogP | 8.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|