C32H46O6 — CID 11954596
(1R,7S,9E,11S,15S,17R)-7-[(E,1S)-3-cyclohexyl-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one (PubChem CID 11954596) has the molecular formula C32H46O6 and a molecular weight of 526.71 g/mol. Its IUPAC name is (1R,7S,9E,11S,15S,17R)-7-[(E,1S)-3-cyclohexyl-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one.
| Compound Name | (1R,7S,9E,11S,15S,17R)-7-[(E,1S)-3-cyclohexyl-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
|---|---|
| PubChem CID | 11954596 |
| Molecular Formula | C32H46O6 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (1R,7S,9E,11S,15S,17R)-7-[(E,1S)-3-cyclohexyl-1-hydroxyprop-2-enyl]-11-(methoxymethoxy)-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
| SMILES | C=C1C[C@H](C)C[C@@H]2CC=C[C@@H](CC#CC(=O)O[C@H]([C@@H](O)/C=C/C3CCCCC3)C/C=C/[C@@H](OCOC)C1)O2 |
| InChI | InChI=1S/C32H46O6/c1-24-20-25(2)22-29-15-7-12-27(37-29)13-9-17-32(34)38-31(16-8-14-28(21-24)36-23-35-3)30(33)19-18-26-10-5-4-6-11-26/h7-8,12,14,18-19,25-31,33H,1,4-6,10-11,13,15-16,20-23H2,2-3H3/b14-8+,19-18+/t25-,27-,28+,29-,30-,31-/m0/s1 |
| InChIKey | ZUVUZONGVTWRRU-RTPZFQCZSA-N |
| XLogP | 5.81 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|