C15H18F4N2O — CID 119546114
[4-fluoro-3-(trifluoromethyl)phenyl]-[4-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 119546114) has the molecular formula C15H18F4N2O and a molecular weight of 318.31 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl]-[4-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl]-[4-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119546114 |
| Molecular Formula | C15H18F4N2O |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl]-[4-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNCC1CCN(C(=O)c2ccc(F)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H18F4N2O/c1-20-9-10-4-6-21(7-5-10)14(22)11-2-3-13(16)12(8-11)15(17,18)19/h2-3,8,10,20H,4-7,9H2,1H3 |
| InChIKey | FUKJXEKTUYFIHU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |