C16H27N5O2 — CID 119546336
N-methyl-N-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-pyrazol-1-ylpropanamide (PubChem CID 119546336) has the molecular formula C16H27N5O2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-methyl-N-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-pyrazol-1-ylpropanamide.
| Compound Name | N-methyl-N-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 119546336 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N-methyl-N-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-pyrazol-1-ylpropanamide |
| SMILES | CNCC1CCN(C(=O)CN(C)C(=O)C(C)n2cccn2)CC1 |
| InChI | InChI=1S/C16H27N5O2/c1-13(21-8-4-7-18-21)16(23)19(3)12-15(22)20-9-5-14(6-10-20)11-17-2/h4,7-8,13-14,17H,5-6,9-12H2,1-3H3 |
| InChIKey | XATNTNVMQPLYSC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |