C14H20Cl2N4O — CID 119547581
N-[2-(4-aminophenyl)ethyl]-2-(1-methylpyrazol-4-yl)acetamide;dihydrochloride (PubChem CID 119547581) has the molecular formula C14H20Cl2N4O and a molecular weight of 331.25 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-(1-methylpyrazol-4-yl)acetamide;dihydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-(1-methylpyrazol-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119547581 |
| Molecular Formula | C14H20Cl2N4O |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-(1-methylpyrazol-4-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc(CC(=O)NCCc2ccc(N)cc2)cn1 |
| InChI | InChI=1S/C14H18N4O.2ClH/c1-18-10-12(9-17-18)8-14(19)16-7-6-11-2-4-13(15)5-3-11;;/h2-5,9-10H,6-8,15H2,1H3,(H,16,19);2*1H |
| InChIKey | FZDLXWAUIFNZDH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|