C18H21FN2O — CID 119548314
N-[2-(4-aminophenyl)ethyl]-3-(3-fluorophenyl)butanamide (PubChem CID 119548314) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3-(3-fluorophenyl)butanamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3-(3-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 119548314 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3-(3-fluorophenyl)butanamide |
| SMILES | CC(CC(=O)NCCc1ccc(N)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H21FN2O/c1-13(15-3-2-4-16(19)12-15)11-18(22)21-10-9-14-5-7-17(20)8-6-14/h2-8,12-13H,9-11,20H2,1H3,(H,21,22) |
| InChIKey | HOSZNTFPFASDGK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|