C19H24BrClN2O — CID 119548358
N-[2-(4-aminophenyl)ethyl]-2-[(2-bromophenyl)methyl]butanamide;hydrochloride (PubChem CID 119548358) has the molecular formula C19H24BrClN2O and a molecular weight of 411.77 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-[(2-bromophenyl)methyl]butanamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-[(2-bromophenyl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119548358 |
| Molecular Formula | C19H24BrClN2O |
| Molecular Weight | 411.77 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-[(2-bromophenyl)methyl]butanamide;hydrochloride |
| SMILES | CCC(Cc1ccccc1Br)C(=O)NCCc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C19H23BrN2O.ClH/c1-2-15(13-16-5-3-4-6-18(16)20)19(23)22-12-11-14-7-9-17(21)10-8-14;/h3-10,15H,2,11-13,21H2,1H3,(H,22,23);1H |
| InChIKey | RNBCFRZALMCPIE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|