C19H24Cl2N4OS — CID 119548962
N-[2-(4-aminophenyl)ethyl]-2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]acetamide;dihydrochloride (PubChem CID 119548962) has the molecular formula C19H24Cl2N4OS and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]acetamide;dihydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119548962 |
| Molecular Formula | C19H24Cl2N4OS |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]acetamide;dihydrochloride |
| SMILES | Cc1ccc2nc(CSCC(=O)NCCc3ccc(N)cc3)cn2c1.Cl.Cl |
| InChI | InChI=1S/C19H22N4OS.2ClH/c1-14-2-7-18-22-17(11-23(18)10-14)12-25-13-19(24)21-9-8-15-3-5-16(20)6-4-15;;/h2-7,10-11H,8-9,12-13,20H2,1H3,(H,21,24);2*1H |
| InChIKey | NTTMJSKHSGLVDY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|