C20H24N4O2 — CID 119549138
N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 119549138) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 119549138 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | Nc1ccc(CCNC(=O)CNC(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C20H24N4O2/c21-18-7-5-15(6-8-18)9-11-22-19(25)13-23-20(26)24-12-10-16-3-1-2-4-17(16)14-24/h1-8H,9-14,21H2,(H,22,25)(H,23,26) |
| InChIKey | GMHHECPLFPBADX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|