C19H27Cl2N5O — CID 119549443
N-[2-(4-aminophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyridine-4-carboxamide;dihydrochloride (PubChem CID 119549443) has the molecular formula C19H27Cl2N5O and a molecular weight of 412.37 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyridine-4-carboxamide;dihydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119549443 |
| Molecular Formula | C19H27Cl2N5O |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-(4-methylpiperazin-1-yl)pyridine-4-carboxamide;dihydrochloride |
| SMILES | CN1CCN(c2cc(C(=O)NCCc3ccc(N)cc3)ccn2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H25N5O.2ClH/c1-23-10-12-24(13-11-23)18-14-16(7-9-21-18)19(25)22-8-6-15-2-4-17(20)5-3-15;;/h2-5,7,9,14H,6,8,10-13,20H2,1H3,(H,22,25);2*1H |
| InChIKey | WMRASBOGWCANTR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|