C17H28N2O2 — CID 119549491
N-[2-(4-aminophenyl)ethyl]-3-(4-methylpentan-2-yloxy)propanamide (PubChem CID 119549491) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3-(4-methylpentan-2-yloxy)propanamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3-(4-methylpentan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 119549491 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3-(4-methylpentan-2-yloxy)propanamide |
| SMILES | CC(C)CC(C)OCCC(=O)NCCc1ccc(N)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-13(2)12-14(3)21-11-9-17(20)19-10-8-15-4-6-16(18)7-5-15/h4-7,13-14H,8-12,18H2,1-3H3,(H,19,20) |
| InChIKey | WTLABYHVSOSPSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|