C18H24Cl3N3O2 — CID 119549697
N-[2-(4-aminophenyl)ethyl]-3-(5-chloro-2-methoxyanilino)propanamide;dihydrochloride (PubChem CID 119549697) has the molecular formula C18H24Cl3N3O2 and a molecular weight of 420.77 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3-(5-chloro-2-methoxyanilino)propanamide;dihydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3-(5-chloro-2-methoxyanilino)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119549697 |
| Molecular Formula | C18H24Cl3N3O2 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3-(5-chloro-2-methoxyanilino)propanamide;dihydrochloride |
| SMILES | COc1ccc(Cl)cc1NCCC(=O)NCCc1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C18H22ClN3O2.2ClH/c1-24-17-7-4-14(19)12-16(17)21-11-9-18(23)22-10-8-13-2-5-15(20)6-3-13;;/h2-7,12,21H,8-11,20H2,1H3,(H,22,23);2*1H |
| InChIKey | KWZLZJDIJKZPSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|