About 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one
6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 11955043) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one.
Molecular Properties
| Compound Name | 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one |
| PubChem CID | 11955043 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C=C=C1CC2CCC(=O)N2C1 |
| InChI | InChI=1S/C9H11NO/c1-2-7-5-8-3-4-9(11)10(8)6-7/h8H,1,3-6H2 |
| InChIKey | BZISXDADJQOZKE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one (CID 11955043) is 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one is C=C=C1CC2CCC(=O)N2C1.
What is the InChIKey of 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is BZISXDADJQOZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-7-5-8-3-4-9(11)10(8)6-7/h8H,1,3-6H2.
What are the key properties of 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one?
6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 149.19 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 11955043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).