C17H29Cl2N3O — CID 119551607
2-(diethylamino)-N-methyl-2-phenyl-N-pyrrolidin-3-ylacetamide;dihydrochloride (PubChem CID 119551607) has the molecular formula C17H29Cl2N3O and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-(diethylamino)-N-methyl-2-phenyl-N-pyrrolidin-3-ylacetamide;dihydrochloride.
| Compound Name | 2-(diethylamino)-N-methyl-2-phenyl-N-pyrrolidin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119551607 |
| Molecular Formula | C17H29Cl2N3O |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-(diethylamino)-N-methyl-2-phenyl-N-pyrrolidin-3-ylacetamide;dihydrochloride |
| SMILES | CCN(CC)C(C(=O)N(C)C1CCNC1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H27N3O.2ClH/c1-4-20(5-2)16(14-9-7-6-8-10-14)17(21)19(3)15-11-12-18-13-15;;/h6-10,15-16,18H,4-5,11-13H2,1-3H3;2*1H |
| InChIKey | ISEYDAHFKVYXEI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |