C17H19N3O — CID 119552362
N-methyl-5-phenyl-N-pyrrolidin-3-ylpyridine-3-carboxamide (PubChem CID 119552362) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-methyl-5-phenyl-N-pyrrolidin-3-ylpyridine-3-carboxamide.
| Compound Name | N-methyl-5-phenyl-N-pyrrolidin-3-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 119552362 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-methyl-5-phenyl-N-pyrrolidin-3-ylpyridine-3-carboxamide |
| SMILES | CN(C(=O)c1cncc(-c2ccccc2)c1)C1CCNC1 |
| InChI | InChI=1S/C17H19N3O/c1-20(16-7-8-18-12-16)17(21)15-9-14(10-19-11-15)13-5-3-2-4-6-13/h2-6,9-11,16,18H,7-8,12H2,1H3 |
| InChIKey | QXZCWLLSNGDVAR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |