C25H36O5 — CID 11955297
7-[(1R,2S,3R)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 11955297) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is 7-[(1R,2S,3R)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 11955297 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 7-[(1R,2S,3R)-2-[4-[cyclohexyl(hydroxy)methyl]phenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1c1ccc(C(O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H36O5/c26-21-16-22(27)24(20(21)10-6-1-2-7-11-23(28)29)17-12-14-19(15-13-17)25(30)18-8-4-3-5-9-18/h12-15,18,20,22,24-25,27,30H,1-11,16H2,(H,28,29)/t20-,22+,24+,25?/m0/s1 |
| InChIKey | IWSXNGMJGVZSIZ-QYJPUHJCSA-N |
| XLogP | 4.76 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|