C20H28O4 — CID 11955313
methyl 7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoate (PubChem CID 11955313) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 11955313 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | methyl 7-[(1R,2S,3R)-3-hydroxy-2-(4-methylphenyl)-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28O4/c1-14-9-11-15(12-10-14)20-16(17(21)13-18(20)22)7-5-3-4-6-8-19(23)24-2/h9-12,16,18,20,22H,3-8,13H2,1-2H3/t16-,18+,20+/m0/s1 |
| InChIKey | PVXQLGVDQMQKID-ILZDJORESA-N |
| XLogP | 3.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|