C22H31ClO3 — CID 11955357
methyl 7-[(1R,2S,3R,5R)-5-chloro-2-(2,3-dihydro-1H-inden-5-yl)-3-hydroxycyclopentyl]heptanoate (PubChem CID 11955357) has the molecular formula C22H31ClO3 and a molecular weight of 378.94 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R,5R)-5-chloro-2-(2,3-dihydro-1H-inden-5-yl)-3-hydroxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,3R,5R)-5-chloro-2-(2,3-dihydro-1H-inden-5-yl)-3-hydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 11955357 |
| Molecular Formula | C22H31ClO3 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | methyl 7-[(1R,2S,3R,5R)-5-chloro-2-(2,3-dihydro-1H-inden-5-yl)-3-hydroxycyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](c2ccc3c(c2)CCC3)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C22H31ClO3/c1-26-21(25)10-5-3-2-4-9-18-19(23)14-20(24)22(18)17-12-11-15-7-6-8-16(15)13-17/h11-13,18-20,22,24H,2-10,14H2,1H3/t18-,19+,20+,22+/m0/s1 |
| InChIKey | OQYUUCYOTLSMRU-GPQLQYNLSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|