C20H25N3O3S — CID 119554301
N,2-dimethyl-5-[(4-methylphenyl)sulfamoyl]-N-pyrrolidin-3-ylbenzamide (PubChem CID 119554301) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N,2-dimethyl-5-[(4-methylphenyl)sulfamoyl]-N-pyrrolidin-3-ylbenzamide.
| Compound Name | N,2-dimethyl-5-[(4-methylphenyl)sulfamoyl]-N-pyrrolidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119554301 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N,2-dimethyl-5-[(4-methylphenyl)sulfamoyl]-N-pyrrolidin-3-ylbenzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)N(C)C3CCNC3)c2)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-14-4-7-16(8-5-14)22-27(25,26)18-9-6-15(2)19(12-18)20(24)23(3)17-10-11-21-13-17/h4-9,12,17,21-22H,10-11,13H2,1-3H3 |
| InChIKey | RNAPJMPLAHXUMI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |