C21H26N2O4 — CID 11955509
[5-(3-aminopropoxy)-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone (PubChem CID 11955509) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [5-(3-aminopropoxy)-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone.
| Compound Name | [5-(3-aminopropoxy)-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 11955509 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [5-(3-aminopropoxy)-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2Cc3ccc(OCCCN)cc3C2)c(O)cc1O |
| InChI | InChI=1S/C21H26N2O4/c1-13(2)17-9-18(20(25)10-19(17)24)21(26)23-11-14-4-5-16(8-15(14)12-23)27-7-3-6-22/h4-5,8-10,13,24-25H,3,6-7,11-12,22H2,1-2H3 |
| InChIKey | DNIWSQGPKWTEIU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|