C17H21N3O — CID 11955514
2,2,3,3-tetramethyl-N'-quinolin-5-ylcyclopropane-1-carbohydrazide (PubChem CID 11955514) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N'-quinolin-5-ylcyclopropane-1-carbohydrazide.
| Compound Name | 2,2,3,3-tetramethyl-N'-quinolin-5-ylcyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 11955514 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2,2,3,3-tetramethyl-N'-quinolin-5-ylcyclopropane-1-carbohydrazide |
| SMILES | CC1(C)C(C(=O)NNc2cccc3ncccc23)C1(C)C |
| InChI | InChI=1S/C17H21N3O/c1-16(2)14(17(16,3)4)15(21)20-19-13-9-5-8-12-11(13)7-6-10-18-12/h5-10,14,19H,1-4H3,(H,20,21) |
| InChIKey | FMLCYNUMLDNELW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|