About 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine
3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine (PubChem CID 11955547) has the molecular formula C23H26N6O
and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine |
| PubChem CID | 11955547 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine |
| SMILES | NCCCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C23H26N6O/c24-12-3-15-29-27-22(26-28-29)18-8-6-17(7-9-18)20-16-23(10-13-25-14-11-23)30-21-5-2-1-4-19(20)21/h1-2,4-9,16,25H,3,10-15,24H2 |
| InChIKey | OTCKIOAPGAQKEP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine?
The IUPAC name of 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine (CID 11955547) is 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine.
What is the SMILES notation for 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine?
The canonical SMILES for 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine is NCCCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1.
What is the InChIKey of 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine?
The InChIKey is OTCKIOAPGAQKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N6O/c24-12-3-15-29-27-22(26-28-29)18-8-6-17(7-9-18)20-16-23(10-13-25-14-11-23)30-21-5-2-1-4-19(20)21/h1-2,4-9,16,25H,3,10-15,24H2.
What are the key properties of 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine?
3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine has a molecular weight of 402.50 g/mol, XLogP of 2.64, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propan-1-amine is sourced from PubChem (CID 11955547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).