About 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine
4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine (PubChem CID 11955549) has the molecular formula C24H28N6O
and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine.
Molecular Properties
| Compound Name | 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine |
| PubChem CID | 11955549 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine |
| SMILES | NCCCCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C24H28N6O/c25-13-3-4-16-30-28-23(27-29-30)19-9-7-18(8-10-19)21-17-24(11-14-26-15-12-24)31-22-6-2-1-5-20(21)22/h1-2,5-10,17,26H,3-4,11-16,25H2 |
| InChIKey | PJFUHAJQXIDSIV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine?
The IUPAC name of 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine (CID 11955549) is 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine.
What is the SMILES notation for 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine?
The canonical SMILES for 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine is NCCCCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1.
What is the InChIKey of 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine?
The InChIKey is PJFUHAJQXIDSIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N6O/c25-13-3-4-16-30-28-23(27-29-30)19-9-7-18(8-10-19)21-17-24(11-14-26-15-12-24)31-22-6-2-1-5-20(21)22/h1-2,5-10,17,26H,3-4,11-16,25H2.
What are the key properties of 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine?
4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine has a molecular weight of 416.53 g/mol, XLogP of 3.03, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]butan-1-amine is sourced from PubChem (CID 11955549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).