About (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone
(5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 11955553) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone.
Molecular Properties
| Compound Name | (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone |
| PubChem CID | 11955553 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | CC(C)(C)c1cc(C(=O)N2Cc3ccccc3C2)c(O)cc1O |
| InChI | InChI=1S/C19H21NO3/c1-19(2,3)15-8-14(16(21)9-17(15)22)18(23)20-10-12-6-4-5-7-13(12)11-20/h4-9,21-22H,10-11H2,1-3H3 |
| InChIKey | FUNJEJVGXFUOOI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone?
The IUPAC name of (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone (CID 11955553) is (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone.
What is the SMILES notation for (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone?
The canonical SMILES for (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone is CC(C)(C)c1cc(C(=O)N2Cc3ccccc3C2)c(O)cc1O.
What is the InChIKey of (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone?
The InChIKey is FUNJEJVGXFUOOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-19(2,3)15-8-14(16(21)9-17(15)22)18(23)20-10-12-6-4-5-7-13(12)11-20/h4-9,21-22H,10-11H2,1-3H3.
What are the key properties of (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone?
(5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone has a molecular weight of 311.38 g/mol, XLogP of 3.55, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-2,4-dihydroxyphenyl)-(1,3-dihydroisoindol-2-yl)methanone is sourced from PubChem (CID 11955553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).