C20H30ClN3O2 — CID 119557113
1-(2-phenylacetyl)-N-(2-piperidin-3-ylethyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119557113) has the molecular formula C20H30ClN3O2 and a molecular weight of 379.93 g/mol. Its IUPAC name is 1-(2-phenylacetyl)-N-(2-piperidin-3-ylethyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 1-(2-phenylacetyl)-N-(2-piperidin-3-ylethyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119557113 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-(2-phenylacetyl)-N-(2-piperidin-3-ylethyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCCNC1)C1CCCN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H29N3O2.ClH/c24-19(14-16-6-2-1-3-7-16)23-13-5-9-18(23)20(25)22-12-10-17-8-4-11-21-15-17;/h1-3,6-7,17-18,21H,4-5,8-15H2,(H,22,25);1H |
| InChIKey | AVGCEMNXYLNCET-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |