C17H20ClN3O2 — CID 119557122
3-(3-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,2-oxazole-5-carboxamide (PubChem CID 119557122) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 119557122 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2-piperidin-3-ylethyl)-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCC1CCCNC1)c1cc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C17H20ClN3O2/c18-14-5-1-4-13(9-14)15-10-16(23-21-15)17(22)20-8-6-12-3-2-7-19-11-12/h1,4-5,9-10,12,19H,2-3,6-8,11H2,(H,20,22) |
| InChIKey | NUBHZVRGCGWWFZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |