C15H21N3O3S — CID 119557437
5-methylsulfanyl-2-nitro-N-(2-piperidin-3-ylethyl)benzamide (PubChem CID 119557437) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 5-methylsulfanyl-2-nitro-N-(2-piperidin-3-ylethyl)benzamide.
| Compound Name | 5-methylsulfanyl-2-nitro-N-(2-piperidin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 119557437 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-methylsulfanyl-2-nitro-N-(2-piperidin-3-ylethyl)benzamide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)NCCC2CCCNC2)c1 |
| InChI | InChI=1S/C15H21N3O3S/c1-22-12-4-5-14(18(20)21)13(9-12)15(19)17-8-6-11-3-2-7-16-10-11/h4-5,9,11,16H,2-3,6-8,10H2,1H3,(H,17,19) |
| InChIKey | UPNPIHPXKPEFSY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|