C18H28ClN3O2S — CID 119557523
2-(4-acetamidophenyl)sulfanyl-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride (PubChem CID 119557523) has the molecular formula C18H28ClN3O2S and a molecular weight of 385.96 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)sulfanyl-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride.
| Compound Name | 2-(4-acetamidophenyl)sulfanyl-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119557523 |
| Molecular Formula | C18H28ClN3O2S |
| Molecular Weight | 385.96 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-(4-acetamidophenyl)sulfanyl-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(SC(C)C(=O)NCCC2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C18H27N3O2S.ClH/c1-13(18(23)20-11-9-15-4-3-10-19-12-15)24-17-7-5-16(6-8-17)21-14(2)22;/h5-8,13,15,19H,3-4,9-12H2,1-2H3,(H,20,23)(H,21,22);1H |
| InChIKey | CXOWEZCSISNCBX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.96 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |