C21H31N3O2 — CID 119557726
1-benzoyl-3-methyl-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide (PubChem CID 119557726) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-benzoyl-3-methyl-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-benzoyl-3-methyl-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119557726 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-benzoyl-3-methyl-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide |
| SMILES | CC1(C(=O)NCCC2CCCNC2)CCCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H31N3O2/c1-21(20(26)23-13-10-17-7-5-12-22-15-17)11-6-14-24(16-21)19(25)18-8-3-2-4-9-18/h2-4,8-9,17,22H,5-7,10-16H2,1H3,(H,23,26) |
| InChIKey | NAEJWLLOLZJGEW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |