C12H18IN3O — CID 119557742
4-iodo-N-(2-piperidin-3-ylethyl)-1H-pyrrole-2-carboxamide (PubChem CID 119557742) has the molecular formula C12H18IN3O and a molecular weight of 347.20 g/mol. Its IUPAC name is 4-iodo-N-(2-piperidin-3-ylethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-iodo-N-(2-piperidin-3-ylethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 119557742 |
| Molecular Formula | C12H18IN3O |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-iodo-N-(2-piperidin-3-ylethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCC1CCCNC1)c1cc(I)c[nH]1 |
| InChI | InChI=1S/C12H18IN3O/c13-10-6-11(16-8-10)12(17)15-5-3-9-2-1-4-14-7-9/h6,8-9,14,16H,1-5,7H2,(H,15,17) |
| InChIKey | FQNUIFIWHRADJH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|