C25H32N2O4 — CID 11955813
[5-[2-(cyclopentylamino)ethoxy]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone (PubChem CID 11955813) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [5-[2-(cyclopentylamino)ethoxy]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone.
| Compound Name | [5-[2-(cyclopentylamino)ethoxy]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 11955813 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [5-[2-(cyclopentylamino)ethoxy]-1,3-dihydroisoindol-2-yl]-(2,4-dihydroxy-5-propan-2-ylphenyl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2Cc3ccc(OCCNC4CCCC4)cc3C2)c(O)cc1O |
| InChI | InChI=1S/C25H32N2O4/c1-16(2)21-12-22(24(29)13-23(21)28)25(30)27-14-17-7-8-20(11-18(17)15-27)31-10-9-26-19-5-3-4-6-19/h7-8,11-13,16,19,26,28-29H,3-6,9-10,14-15H2,1-2H3 |
| InChIKey | IVKPVAABBQNPCR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|