C16H22ClN5O — CID 119558694
2-phenyl-N-(2-piperidin-3-ylethyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119558694) has the molecular formula C16H22ClN5O and a molecular weight of 335.84 g/mol. Its IUPAC name is 2-phenyl-N-(2-piperidin-3-ylethyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 2-phenyl-N-(2-piperidin-3-ylethyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119558694 |
| Molecular Formula | C16H22ClN5O |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-phenyl-N-(2-piperidin-3-ylethyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCCNC1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H21N5O.ClH/c22-16(18-10-8-13-5-4-9-17-11-13)15-12-19-21(20-15)14-6-2-1-3-7-14;/h1-3,6-7,12-13,17H,4-5,8-11H2,(H,18,22);1H |
| InChIKey | ADNCQJRWHJTBSL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |