C17H27ClN2O4S — CID 119558807
3-(4-methylsulfonylphenoxy)-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride (PubChem CID 119558807) has the molecular formula C17H27ClN2O4S and a molecular weight of 390.93 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenoxy)-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride.
| Compound Name | 3-(4-methylsulfonylphenoxy)-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119558807 |
| Molecular Formula | C17H27ClN2O4S |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-(4-methylsulfonylphenoxy)-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(OCCC(=O)NCCC2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C17H26N2O4S.ClH/c1-24(21,22)16-6-4-15(5-7-16)23-12-9-17(20)19-11-8-14-3-2-10-18-13-14;/h4-7,14,18H,2-3,8-13H2,1H3,(H,19,20);1H |
| InChIKey | WQZFHASNSVEDOR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |