C18H22F3N3O2 — CID 119561222
1-[3-[4-(methylamino)piperidine-1-carbonyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 119561222) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-[3-[4-(methylamino)piperidine-1-carbonyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-(methylamino)piperidine-1-carbonyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 119561222 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[3-[4-(methylamino)piperidine-1-carbonyl]-5-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CNC1CCN(C(=O)c2cc(N3CCCC3=O)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-22-14-4-7-23(8-5-14)17(26)12-9-13(18(19,20)21)11-15(10-12)24-6-2-3-16(24)25/h9-11,14,22H,2-8H2,1H3 |
| InChIKey | KJRVFZWBPWWZFY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |