C18H29ClN4O2 — CID 119561837
1-benzyl-1-methyl-3-[3-[4-(methylamino)piperidin-1-yl]-3-oxopropyl]urea;hydrochloride (PubChem CID 119561837) has the molecular formula C18H29ClN4O2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 1-benzyl-1-methyl-3-[3-[4-(methylamino)piperidin-1-yl]-3-oxopropyl]urea;hydrochloride.
| Compound Name | 1-benzyl-1-methyl-3-[3-[4-(methylamino)piperidin-1-yl]-3-oxopropyl]urea;hydrochloride |
|---|---|
| PubChem CID | 119561837 |
| Molecular Formula | C18H29ClN4O2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-benzyl-1-methyl-3-[3-[4-(methylamino)piperidin-1-yl]-3-oxopropyl]urea;hydrochloride |
| SMILES | CNC1CCN(C(=O)CCNC(=O)N(C)Cc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C18H28N4O2.ClH/c1-19-16-9-12-22(13-10-16)17(23)8-11-20-18(24)21(2)14-15-6-4-3-5-7-15;/h3-7,16,19H,8-14H2,1-2H3,(H,20,24);1H |
| InChIKey | ZKFUYBYLUGHISA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |