C17H21ClN2O3 — CID 119561915
[4-(methylamino)piperidin-1-yl]-(5-phenoxyfuran-2-yl)methanone;hydrochloride (PubChem CID 119561915) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is [4-(methylamino)piperidin-1-yl]-(5-phenoxyfuran-2-yl)methanone;hydrochloride.
| Compound Name | [4-(methylamino)piperidin-1-yl]-(5-phenoxyfuran-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119561915 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [4-(methylamino)piperidin-1-yl]-(5-phenoxyfuran-2-yl)methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2ccc(Oc3ccccc3)o2)CC1.Cl |
| InChI | InChI=1S/C17H20N2O3.ClH/c1-18-13-9-11-19(12-10-13)17(20)15-7-8-16(22-15)21-14-5-3-2-4-6-14;/h2-8,13,18H,9-12H2,1H3;1H |
| InChIKey | SDGFCEWOBZQAOS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |